C27H19Cl4N3O5 — CID 126270102
2-[2,6-dichloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126270102) has the molecular formula C27H19Cl4N3O5 and a molecular weight of 607.28 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126270102 |
| Molecular Formula | C27H19Cl4N3O5 |
| Molecular Weight | 607.28 g/mol |
| Exact Mass | 605.01 |
| IUPAC Name | 2-[2,6-dichloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(/C=C3/C(=O)NC(=O)N(c4ccc(Cl)c(Cl)c4)C3=O)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C27H19Cl4N3O5/c1-13-3-6-22(14(2)7-13)32-23(35)12-39-24-20(30)9-15(10-21(24)31)8-17-25(36)33-27(38)34(26(17)37)16-4-5-18(28)19(29)11-16/h3-11H,12H2,1-2H3,(H,32,35)(H,33,36,38)/b17-8- |
| InChIKey | IREVUCNNCYPGMJ-IUXPMGMMSA-N |
| XLogP | 6.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.28 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|