C27H20BrCl2N3O6 — CID 126263802
2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126263802) has the molecular formula C27H20BrCl2N3O6 and a molecular weight of 633.28 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126263802 |
| Molecular Formula | C27H20BrCl2N3O6 |
| Molecular Weight | 633.28 g/mol |
| Exact Mass | 630.99 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc(Br)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H20BrCl2N3O6/c1-14-5-3-4-6-21(14)31-23(34)13-39-24-18(28)10-15(11-22(24)38-2)9-17-25(35)32-27(37)33(26(17)36)16-7-8-19(29)20(30)12-16/h3-12H,13H2,1-2H3,(H,31,34)(H,32,35,37)/b17-9- |
| InChIKey | SXWGFOHYUIEUDL-MFOYZWKCSA-N |
| XLogP | 5.76 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.28 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|