C33H34BrN3O8 — CID 126260327
2-[2-bromo-6-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126260327) has the molecular formula C33H34BrN3O8 and a molecular weight of 680.55 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126260327 |
| Molecular Formula | C33H34BrN3O8 |
| Molecular Weight | 680.55 g/mol |
| Exact Mass | 679.15 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Br)c(OCC(=O)Nc4ccccc4C)c(OCC)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C33H34BrN3O8/c1-5-14-44-26-13-12-22(18-27(26)42-6-2)37-32(40)23(31(39)36-33(37)41)15-21-16-24(34)30(28(17-21)43-7-3)45-19-29(38)35-25-11-9-8-10-20(25)4/h8-13,15-18H,5-7,14,19H2,1-4H3,(H,35,38)(H,36,39,41)/b23-15+ |
| InChIKey | HVXDHYNKTYVHSY-HZHRSRAPSA-N |
| XLogP | 6.03 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|