C33H35N3O9 — CID 126382852
2-[2-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 126382852) has the molecular formula C33H35N3O9 and a molecular weight of 617.66 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126382852 |
| Molecular Formula | C33H35N3O9 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(OCC(=O)Nc4ccccc4OC)c(OCC)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C33H35N3O9/c1-5-16-44-26-15-13-22(19-29(26)43-7-3)36-32(39)23(31(38)35-33(36)40)17-21-12-14-27(28(18-21)42-6-2)45-20-30(37)34-24-10-8-9-11-25(24)41-4/h8-15,17-19H,5-7,16,20H2,1-4H3,(H,34,37)(H,35,38,40)/b23-17+ |
| InChIKey | OHXCTORYAGVHPJ-HAVVHWLPSA-N |
| XLogP | 4.97 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|