C31H31N3O9 — CID 126374885
2-[2-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 126374885) has the molecular formula C31H31N3O9 and a molecular weight of 589.60 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126374885 |
| Molecular Formula | C31H31N3O9 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C/c3ccc(OCC(=O)Nc4ccc(OC)cc4)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C31H31N3O9/c1-5-14-42-24-13-9-21(17-27(24)41-4)34-30(37)23(29(36)33-31(34)38)15-19-6-12-25(26(16-19)40-3)43-18-28(35)32-20-7-10-22(39-2)11-8-20/h6-13,15-17H,5,14,18H2,1-4H3,(H,32,35)(H,33,36,38)/b23-15- |
| InChIKey | NNNDPBGOGGXSHI-HAHDFKILSA-N |
| XLogP | 4.19 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|