C26H18Cl3N3O6 — CID 126385808
2-[2-chloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 126385808) has the molecular formula C26H18Cl3N3O6 and a molecular weight of 574.80 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126385808 |
| Molecular Formula | C26H18Cl3N3O6 |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=C3/C(=O)NC(=O)N(c4ccc(Cl)c(Cl)c4)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C26H18Cl3N3O6/c1-37-17-6-3-15(4-7-17)30-23(33)13-38-22-9-2-14(11-21(22)29)10-18-24(34)31-26(36)32(25(18)35)16-5-8-19(27)20(28)12-16/h2-12H,13H2,1H3,(H,30,33)(H,31,34,36)/b18-10- |
| InChIKey | DTYPWXDAFSNTCA-ZDLGFXPLSA-N |
| XLogP | 5.34 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|