C26H19Cl2N3O6 — CID 126385449
2-[2-chloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 126385449) has the molecular formula C26H19Cl2N3O6 and a molecular weight of 540.36 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126385449 |
| Molecular Formula | C26H19Cl2N3O6 |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=C3\C(=O)NC(=O)N(c4cccc(Cl)c4)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C26H19Cl2N3O6/c1-36-19-8-6-17(7-9-19)29-23(32)14-37-22-10-5-15(12-21(22)28)11-20-24(33)30-26(35)31(25(20)34)18-4-2-3-16(27)13-18/h2-13H,14H2,1H3,(H,29,32)(H,30,33,35)/b20-11+ |
| InChIKey | PRZHNFKTYTTYLS-RGVLZGJSSA-N |
| XLogP | 4.69 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|