C26H20ClN3O5S — CID 126384298
2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 126384298) has the molecular formula C26H20ClN3O5S and a molecular weight of 521.98 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126384298 |
| Molecular Formula | C26H20ClN3O5S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=C3/C(=O)NC(=S)N(c4ccccc4)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C26H20ClN3O5S/c1-34-19-10-8-17(9-11-19)28-23(31)15-35-22-12-7-16(14-21(22)27)13-20-24(32)29-26(36)30(25(20)33)18-5-3-2-4-6-18/h2-14H,15H2,1H3,(H,28,31)(H,29,32,36)/b20-13- |
| InChIKey | ZQETWDUTRCWHCV-MOSHPQCFSA-N |
| XLogP | 4.20 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|