C26H19Cl2N3O4S — CID 126264080
2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 126264080) has the molecular formula C26H19Cl2N3O4S and a molecular weight of 540.43 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126264080 |
| Molecular Formula | C26H19Cl2N3O4S |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C3/C(=O)NC(=S)N(c4ccccc4)C3=O)cc2Cl)cc1Cl |
| InChI | InChI=1S/C26H19Cl2N3O4S/c1-15-7-9-17(13-20(15)27)29-23(32)14-35-22-10-8-16(12-21(22)28)11-19-24(33)30-26(36)31(25(19)34)18-5-3-2-4-6-18/h2-13H,14H2,1H3,(H,29,32)(H,30,33,36)/b19-11- |
| InChIKey | UNWKYGFRGNMADX-ODLFYWEKSA-N |
| XLogP | 5.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|