C28H24ClN3O5S — CID 126259144
N-(3-chloro-4-methylphenyl)-2-[4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 126259144) has the molecular formula C28H24ClN3O5S and a molecular weight of 550.04 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126259144 |
| Molecular Formula | C28H24ClN3O5S |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=S)N(c3ccccc3)C2=O)ccc1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C28H24ClN3O5S/c1-3-36-24-14-18(10-12-23(24)37-16-25(33)30-19-11-9-17(2)22(29)15-19)13-21-26(34)31-28(38)32(27(21)35)20-7-5-4-6-8-20/h4-15H,3,16H2,1-2H3,(H,30,33)(H,31,34,38)/b21-13- |
| InChIKey | AEJHUBYVGRDLSX-BKUYFWCQSA-N |
| XLogP | 4.90 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|