C28H25N3O5S — CID 126391876
N-(3,4-dimethylphenyl)-2-[3-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126391876) has the molecular formula C28H25N3O5S and a molecular weight of 515.59 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[3-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[3-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126391876 |
| Molecular Formula | C28H25N3O5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[3-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3cccc(OCC(=O)Nc4ccc(C)c(C)c4)c3)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C28H25N3O5S/c1-17-7-8-20(13-18(17)2)29-25(32)16-36-23-6-4-5-19(14-23)15-24-26(33)30-28(37)31(27(24)34)21-9-11-22(35-3)12-10-21/h4-15H,16H2,1-3H3,(H,29,32)(H,30,33,37)/b24-15+ |
| InChIKey | PXCZDGJZOSEQSI-BUVRLJJBSA-N |
| XLogP | 4.16 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|