C28H22ClN3O7 — CID 126268337
methyl 4-[(5Z)-5-[[3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126268337) has the molecular formula C28H22ClN3O7 and a molecular weight of 547.95 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[[3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-5-[[3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126268337 |
| Molecular Formula | C28H22ClN3O7 |
| Molecular Weight | 547.95 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | methyl 4-[(5Z)-5-[[3-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C/c3cccc(OCC(=O)Nc4ccc(C)c(Cl)c4)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H22ClN3O7/c1-16-6-9-19(14-23(16)29)30-24(33)15-39-21-5-3-4-17(12-21)13-22-25(34)31-28(37)32(26(22)35)20-10-7-18(8-11-20)27(36)38-2/h3-14H,15H2,1-2H3,(H,30,33)(H,31,34,37)/b22-13- |
| InChIKey | FTVBDZQNMHEMSQ-XKZIYDEJSA-N |
| XLogP | 4.12 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|