C27H21N3O7 — CID 126270413
methyl 4-[(5Z)-5-[[3-(2-anilino-2-oxoethoxy)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126270413) has the molecular formula C27H21N3O7 and a molecular weight of 499.48 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[[3-(2-anilino-2-oxoethoxy)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-5-[[3-(2-anilino-2-oxoethoxy)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126270413 |
| Molecular Formula | C27H21N3O7 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | methyl 4-[(5Z)-5-[[3-(2-anilino-2-oxoethoxy)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C/c3cccc(OCC(=O)Nc4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H21N3O7/c1-36-26(34)18-10-12-20(13-11-18)30-25(33)22(24(32)29-27(30)35)15-17-6-5-9-21(14-17)37-16-23(31)28-19-7-3-2-4-8-19/h2-15H,16H2,1H3,(H,28,31)(H,29,32,35)/b22-15- |
| InChIKey | PZALDFJHBLVPRO-JCMHNJIXSA-N |
| XLogP | 3.16 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|