C25H19N3O6 — CID 121238145
2-[3-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 121238145) has the molecular formula C25H19N3O6 and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-[3-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[3-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 121238145 |
| Molecular Formula | C25H19N3O6 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-[3-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1cccc(/C=C2/C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)c1)Nc1ccccc1 |
| InChI | InChI=1S/C25H19N3O6/c29-19-11-9-18(10-12-19)28-24(32)21(23(31)27-25(28)33)14-16-5-4-8-20(13-16)34-15-22(30)26-17-6-2-1-3-7-17/h1-14,29H,15H2,(H,26,30)(H,27,31,33)/b21-14- |
| InChIKey | HHYIBBMMWAMSAH-STZFKDTASA-N |
| XLogP | 3.08 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|