C32H24ClN3O6 — CID 126232676
N-(4-chlorophenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126232676) has the molecular formula C32H24ClN3O6 and a molecular weight of 582.01 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126232676 |
| Molecular Formula | C32H24ClN3O6 |
| Molecular Weight | 582.01 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | O=C(COc1cccc(/C=C2/C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H24ClN3O6/c33-23-9-11-24(12-10-23)34-29(37)20-42-27-8-4-7-22(17-27)18-28-30(38)35-32(40)36(31(28)39)25-13-15-26(16-14-25)41-19-21-5-2-1-3-6-21/h1-18H,19-20H2,(H,34,37)(H,35,38,40)/b28-18- |
| InChIKey | UEJLTKLKSAWZMM-VEILYXNESA-N |
| XLogP | 5.60 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|