C25H18N4O7 — CID 126267182
2-[3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 126267182) has the molecular formula C25H18N4O7 and a molecular weight of 486.44 g/mol. Its IUPAC name is 2-[3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126267182 |
| Molecular Formula | C25H18N4O7 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-[3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1cccc(/C=C2/C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)c1)Nc1ccccc1 |
| InChI | InChI=1S/C25H18N4O7/c30-22(26-17-6-2-1-3-7-17)15-36-20-8-4-5-16(13-20)14-21-23(31)27-25(33)28(24(21)32)18-9-11-19(12-10-18)29(34)35/h1-14H,15H2,(H,26,30)(H,27,31,33)/b21-14- |
| InChIKey | ZTTGHZXBSRAGPT-STZFKDTASA-N |
| XLogP | 3.28 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|