C33H27N3O7 — CID 126389633
N-(4-methoxyphenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126389633) has the molecular formula C33H27N3O7 and a molecular weight of 577.59 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126389633 |
| Molecular Formula | C33H27N3O7 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[3-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(NC(=O)COc2cccc(/C=C3/C(=O)NC(=O)N(c4ccc(OCc5ccccc5)cc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C33H27N3O7/c1-41-26-14-10-24(11-15-26)34-30(37)21-43-28-9-5-8-23(18-28)19-29-31(38)35-33(40)36(32(29)39)25-12-16-27(17-13-25)42-20-22-6-3-2-4-7-22/h2-19H,20-21H2,1H3,(H,34,37)(H,35,38,40)/b29-19- |
| InChIKey | HDKNSRBFGJOTJI-CEUNXORHSA-N |
| XLogP | 4.96 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|