C25H18FN3O5 — CID 3651383
N-(4-fluorophenyl)-2-[3-[(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 3651383) has the molecular formula C25H18FN3O5 and a molecular weight of 459.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-[(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-[(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 3651383 |
| Molecular Formula | C25H18FN3O5 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-[(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C=C2C(=O)NC(=O)N(c3ccccc3)C2=O)c1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H18FN3O5/c26-17-9-11-18(12-10-17)27-22(30)15-34-20-8-4-5-16(13-20)14-21-23(31)28-25(33)29(24(21)32)19-6-2-1-3-7-19/h1-14H,15H2,(H,27,30)(H,28,31,33) |
| InChIKey | RKOQEYINXZVEGO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|