C19H14FN3O4S — CID 4236727
2-[3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 4236727) has the molecular formula C19H14FN3O4S and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-[3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4236727 |
| Molecular Formula | C19H14FN3O4S |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-[3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1cccc(C=C2C(=O)NC(=S)NC2=O)c1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FN3O4S/c20-12-4-6-13(7-5-12)21-16(24)10-27-14-3-1-2-11(8-14)9-15-17(25)22-19(28)23-18(15)26/h1-9H,10H2,(H,21,24)(H2,22,23,25,26,28) |
| InChIKey | CUGDDLDIXAHHDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|