C19H13BrFN3O4S — CID 4552914
2-[4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 4552914) has the molecular formula C19H13BrFN3O4S and a molecular weight of 478.30 g/mol. Its IUPAC name is 2-[4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4552914 |
| Molecular Formula | C19H13BrFN3O4S |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | 2-[4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1C=C1C(=O)NC(=S)NC1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H13BrFN3O4S/c20-11-1-6-15(28-9-16(25)22-13-4-2-12(21)3-5-13)10(7-11)8-14-17(26)23-19(29)24-18(14)27/h1-8H,9H2,(H,22,25)(H2,23,24,26,27,29) |
| InChIKey | VUNCZEKWPXJWLJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|