C25H18FN3O4S — CID 6505312
2-[2-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 6505312) has the molecular formula C25H18FN3O4S and a molecular weight of 475.50 g/mol. Its IUPAC name is 2-[2-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 6505312 |
| Molecular Formula | C25H18FN3O4S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-[2-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccccc1/C=C1\C(=O)NC(=S)N(c2ccccc2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H18FN3O4S/c26-17-10-12-18(13-11-17)27-22(30)15-33-21-9-5-4-6-16(21)14-20-23(31)28-25(34)29(24(20)32)19-7-2-1-3-8-19/h1-14H,15H2,(H,27,30)(H,28,31,34)/b20-14+ |
| InChIKey | VYKVYSCNVNVBOK-XSFVSMFZSA-N |
| XLogP | 3.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|