C26H20BrN3O4S — CID 126268236
2-[4-bromo-2-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126268236) has the molecular formula C26H20BrN3O4S and a molecular weight of 550.43 g/mol. Its IUPAC name is 2-[4-bromo-2-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126268236 |
| Molecular Formula | C26H20BrN3O4S |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | 2-[4-bromo-2-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Br)cc2/C=C2/C(=O)NC(=S)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C26H20BrN3O4S/c1-16-6-5-7-19(12-16)28-23(31)15-34-22-11-10-18(27)13-17(22)14-21-24(32)29-26(35)30(25(21)33)20-8-3-2-4-9-20/h2-14H,15H2,1H3,(H,28,31)(H,29,32,35)/b21-14- |
| InChIKey | CKGWUSFHQYCXIK-STZFKDTASA-N |
| XLogP | 4.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|