C26H19BrClN3O5 — CID 126050192
2-[4-bromo-2-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126050192) has the molecular formula C26H19BrClN3O5 and a molecular weight of 568.81 g/mol. Its IUPAC name is 2-[4-bromo-2-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126050192 |
| Molecular Formula | C26H19BrClN3O5 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | 2-[4-bromo-2-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Br)cc2/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C26H19BrClN3O5/c1-15-4-2-6-19(10-15)29-23(32)14-36-22-9-8-17(27)11-16(22)12-21-24(33)30-26(35)31(25(21)34)20-7-3-5-18(28)13-20/h2-13H,14H2,1H3,(H,29,32)(H,30,33,35)/b21-12+ |
| InChIKey | ALYLBTSLWYCLDL-CIAFOILYSA-N |
| XLogP | 5.09 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|