C32H24BrN3O5 — CID 126270238
2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126270238) has the molecular formula C32H24BrN3O5 and a molecular weight of 610.46 g/mol. Its IUPAC name is 2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126270238 |
| Molecular Formula | C32H24BrN3O5 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | 2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(Br)cc1C=C1C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C32H24BrN3O5/c1-21-10-8-9-15-27(21)34-29(37)20-41-28-17-16-23(33)18-22(28)19-26-30(38)35(24-11-4-2-5-12-24)32(40)36(31(26)39)25-13-6-3-7-14-25/h2-19H,20H2,1H3,(H,34,37) |
| InChIKey | KMYZDELHWQPDCT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|