C27H22BrN3O6 — CID 126273685
2-[4-bromo-2-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126273685) has the molecular formula C27H22BrN3O6 and a molecular weight of 564.39 g/mol. Its IUPAC name is 2-[4-bromo-2-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126273685 |
| Molecular Formula | C27H22BrN3O6 |
| Molecular Weight | 564.39 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | 2-[4-bromo-2-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Br)cc2/C=C2/C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)c1C |
| InChI | InChI=1S/C27H22BrN3O6/c1-15-4-3-5-22(16(15)2)29-24(33)14-37-23-11-6-18(28)12-17(23)13-21-25(34)30-27(36)31(26(21)35)19-7-9-20(32)10-8-19/h3-13,32H,14H2,1-2H3,(H,29,33)(H,30,34,36)/b21-13- |
| InChIKey | NCIPHDXONQNIRJ-BKUYFWCQSA-N |
| XLogP | 4.46 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|