C29H27N3O7 — CID 126276537
N-(2,3-dimethylphenyl)-2-[2-methoxy-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126276537) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[2-methoxy-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[2-methoxy-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126276537 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[2-methoxy-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(OCC(=O)Nc4cccc(C)c4C)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H27N3O7/c1-17-6-5-7-23(18(17)2)30-26(33)16-39-24-13-8-19(15-25(24)38-4)14-22-27(34)31-29(36)32(28(22)35)20-9-11-21(37-3)12-10-20/h5-15H,16H2,1-4H3,(H,30,33)(H,31,34,36)/b22-14+ |
| InChIKey | DZMQMYIMLQSKDM-HYARGMPZSA-N |
| XLogP | 4.00 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|