C30H29N3O7 — CID 126259096
N-(2,3-dimethylphenyl)-2-[4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 126259096) has the molecular formula C30H29N3O7 and a molecular weight of 543.58 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126259096 |
| Molecular Formula | C30H29N3O7 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | CCOc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(OCC(=O)Nc4cccc(C)c4C)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O7/c1-5-39-22-12-10-21(11-13-22)33-29(36)23(28(35)32-30(33)37)15-20-9-14-25(26(16-20)38-4)40-17-27(34)31-24-8-6-7-18(2)19(24)3/h6-16H,5,17H2,1-4H3,(H,31,34)(H,32,35,37)/b23-15+ |
| InChIKey | ACELVUMJRDDIAR-HZHRSRAPSA-N |
| XLogP | 4.39 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|