C34H29N3O8 — CID 126374798
N-(2-methoxyphenyl)-2-[2-methoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126374798) has the molecular formula C34H29N3O8 and a molecular weight of 607.62 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[2-methoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[2-methoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126374798 |
| Molecular Formula | C34H29N3O8 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[2-methoxy-4-[(Z)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2/C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C34H29N3O8/c1-42-28-11-7-6-10-27(28)35-31(38)21-45-29-17-12-23(19-30(29)43-2)18-26-32(39)36-34(41)37(33(26)40)24-13-15-25(16-14-24)44-20-22-8-4-3-5-9-22/h3-19H,20-21H2,1-2H3,(H,35,38)(H,36,39,41)/b26-18- |
| InChIKey | MDXSOHQPLAXFMY-ITYLOYPMSA-N |
| XLogP | 4.97 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|