C33H26N2O8 — CID 126082456
4-[[2-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126082456) has the molecular formula C33H26N2O8 and a molecular weight of 578.58 g/mol. Its IUPAC name is 4-[[2-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126082456 |
| Molecular Formula | C33H26N2O8 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 4-[[2-methoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H26N2O8/c1-41-29-18-23(9-16-28(29)43-20-22-7-10-24(11-8-22)32(38)39)17-27-30(36)34-33(40)35(31(27)37)25-12-14-26(15-13-25)42-19-21-5-3-2-4-6-21/h2-18H,19-20H2,1H3,(H,38,39)(H,34,36,40)/b27-17+ |
| InChIKey | XRXDXZIEVPYBFS-WPWMEQJKSA-N |
| XLogP | 5.22 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|