C28H23BrN2O8 — CID 126078715
4-[[2-bromo-4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126078715) has the molecular formula C28H23BrN2O8 and a molecular weight of 595.40 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126078715 |
| Molecular Formula | C28H23BrN2O8 |
| Molecular Weight | 595.40 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Br)c(OCc4ccc(C(=O)O)cc4)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H23BrN2O8/c1-3-38-20-10-8-19(9-11-20)31-26(33)21(25(32)30-28(31)36)12-17-13-22(29)24(23(14-17)37-2)39-15-16-4-6-18(7-5-16)27(34)35/h4-14H,3,15H2,1-2H3,(H,34,35)(H,30,32,36)/b21-12+ |
| InChIKey | NBIJXWRTCMOXKL-CIAFOILYSA-N |
| XLogP | 4.80 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|