C26H19IN2O8 — CID 126076960
4-[[4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126076960) has the molecular formula C26H19IN2O8 and a molecular weight of 614.35 g/mol. Its IUPAC name is 4-[[4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126076960 |
| Molecular Formula | C26H19IN2O8 |
| Molecular Weight | 614.35 g/mol |
| Exact Mass | 614.02 |
| IUPAC Name | 4-[[4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)cc(I)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H19IN2O8/c1-36-21-12-15(11-20(27)22(21)37-13-14-2-4-16(5-3-14)25(33)34)10-19-23(31)28-26(35)29(24(19)32)17-6-8-18(30)9-7-17/h2-12,30H,13H2,1H3,(H,33,34)(H,28,31,35)/b19-10+ |
| InChIKey | CJDPRHYQZCOOAI-VXLYETTFSA-N |
| XLogP | 3.95 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|