C26H18IN3O9 — CID 126070550
4-[[2-iodo-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126070550) has the molecular formula C26H18IN3O9 and a molecular weight of 643.35 g/mol. Its IUPAC name is 4-[[2-iodo-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-iodo-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126070550 |
| Molecular Formula | C26H18IN3O9 |
| Molecular Weight | 643.35 g/mol |
| Exact Mass | 643.01 |
| IUPAC Name | 4-[[2-iodo-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc(I)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H18IN3O9/c1-38-21-11-15(10-20(27)22(21)39-13-14-5-7-16(8-6-14)25(33)34)9-19-23(31)28-26(35)29(24(19)32)17-3-2-4-18(12-17)30(36)37/h2-12H,13H2,1H3,(H,33,34)(H,28,31,35)/b19-9+ |
| InChIKey | BXHHLTVUYNEIQU-DJKKODMXSA-N |
| XLogP | 4.15 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|