C23H19N3O9 — CID 126076687
2-[2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetic acid (PubChem CID 126076687) has the molecular formula C23H19N3O9 and a molecular weight of 481.42 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetic acid |
|---|---|
| PubChem CID | 126076687 |
| Molecular Formula | C23H19N3O9 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenoxy]acetic acid |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C23H19N3O9/c1-3-5-14-8-13(10-18(34-2)20(14)35-12-19(27)28)9-17-21(29)24-23(31)25(22(17)30)15-6-4-7-16(11-15)26(32)33/h3-4,6-11H,1,5,12H2,2H3,(H,27,28)(H,24,29,31)/b17-9+ |
| InChIKey | NXOUYHBNBASOKI-RQZCQDPDSA-N |
| XLogP | 2.46 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|