C27H21N3O9S — CID 126076911
[2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126076911) has the molecular formula C27H21N3O9S and a molecular weight of 563.54 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126076911 |
| Molecular Formula | C27H21N3O9S |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | [2-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc(OC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H21N3O9S/c1-3-8-18-13-17(15-23(38-2)24(18)39-40(36,37)21-11-5-4-6-12-21)14-22-25(31)28-27(33)29(26(22)32)19-9-7-10-20(16-19)30(34)35/h3-7,9-16H,1,8H2,2H3,(H,28,31,33)/b22-14+ |
| InChIKey | BZTVSXCURJLEPM-HYARGMPZSA-N |
| XLogP | 3.77 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|