C19H12N3O8- — CID 2179362
2-methoxy-5-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate (PubChem CID 2179362) has the molecular formula C19H12N3O8- and a molecular weight of 410.32 g/mol. Its IUPAC name is 2-methoxy-5-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate.
| Compound Name | 2-methoxy-5-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2179362 |
| Molecular Formula | C19H12N3O8- |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-methoxy-5-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=C2/C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc1C(=O)[O-] |
| InChI | InChI=1S/C19H13N3O8/c1-30-15-6-5-10(7-13(15)18(25)26)8-14-16(23)20-19(27)21(17(14)24)11-3-2-4-12(9-11)22(28)29/h2-9H,1H3,(H,25,26)(H,20,23,27)/p-1/b14-8- |
| InChIKey | HWNTZGPNIAVPCP-ZSOIEALJSA-M |
| XLogP | 0.63 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|