C26H20N4O8 — CID 126070121
2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126070121) has the molecular formula C26H20N4O8 and a molecular weight of 516.47 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126070121 |
| Molecular Formula | C26H20N4O8 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=C2/C(=O)NC(=O)N(c3ccccc3)C2=O)ccc1OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H20N4O8/c1-37-22-13-16(12-20-24(32)28-26(34)29(25(20)33)18-7-3-2-4-8-18)10-11-21(22)38-15-23(31)27-17-6-5-9-19(14-17)30(35)36/h2-14H,15H2,1H3,(H,27,31)(H,28,32,34)/b20-12- |
| InChIKey | MLMZYZXPPYVFAL-NDENLUEZSA-N |
| XLogP | 3.29 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|