C34H28N4O7S — CID 126069425
2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-3-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126069425) has the molecular formula C34H28N4O7S and a molecular weight of 636.69 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-3-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-3-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126069425 |
| Molecular Formula | C34H28N4O7S |
| Molecular Weight | 636.69 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | 2-[4-[(E)-[1-(3,4-dimethylphenyl)-4,6-dioxo-3-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=C2\C(=O)N(c3ccccc3)C(=S)N(c3ccc(C)c(C)c3)C2=O)ccc1OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H28N4O7S/c1-21-12-14-26(16-22(21)2)37-33(41)28(32(40)36(34(37)46)25-9-5-4-6-10-25)17-23-13-15-29(30(18-23)44-3)45-20-31(39)35-24-8-7-11-27(19-24)38(42)43/h4-19H,20H2,1-3H3,(H,35,39)/b28-17+ |
| InChIKey | FZXMVPVHHQLCBM-OGLMXYFKSA-N |
| XLogP | 5.99 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|