C27H21BrN4O7 — CID 126260445
2-[2-bromo-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 126260445) has the molecular formula C27H21BrN4O7 and a molecular weight of 593.39 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126260445 |
| Molecular Formula | C27H21BrN4O7 |
| Molecular Weight | 593.39 g/mol |
| Exact Mass | 592.06 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C3/C(=O)NC(=O)N(c4cccc([N+](=O)[O-])c4)C3=O)cc2Br)cc1C |
| InChI | InChI=1S/C27H21BrN4O7/c1-15-6-8-18(10-16(15)2)29-24(33)14-39-23-9-7-17(12-22(23)28)11-21-25(34)30-27(36)31(26(21)35)19-4-3-5-20(13-19)32(37)38/h3-13H,14H2,1-2H3,(H,29,33)(H,30,34,36)/b21-11- |
| InChIKey | WSPFBGMEDZWVQS-NHDPSOOVSA-N |
| XLogP | 4.66 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|