C26H18F3N3O6S2 — CID 126345243
2-[2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126345243) has the molecular formula C26H18F3N3O6S2 and a molecular weight of 589.57 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126345243 |
| Molecular Formula | C26H18F3N3O6S2 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)ccc1OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H18F3N3O6S2/c1-37-21-10-15(8-9-20(21)38-14-23(33)30-17-5-3-7-19(13-17)32(35)36)11-22-24(34)31(25(39)40-22)18-6-2-4-16(12-18)26(27,28)29/h2-13H,14H2,1H3,(H,30,33)/b22-11+ |
| InChIKey | RXYRXXVCFWSWQE-SSDVNMTOSA-N |
| XLogP | 6.05 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|