C27H21F3N2O4S2 — CID 126251689
2-[2-methoxy-4-[(Z)-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126251689) has the molecular formula C27H21F3N2O4S2 and a molecular weight of 558.60 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126251689 |
| Molecular Formula | C27H21F3N2O4S2 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3ccc(C)cc3)C2=O)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H21F3N2O4S2/c1-16-6-9-20(10-7-16)32-25(34)23(38-26(32)37)13-17-8-11-21(22(12-17)35-2)36-15-24(33)31-19-5-3-4-18(14-19)27(28,29)30/h3-14H,15H2,1-2H3,(H,31,33)/b23-13- |
| InChIKey | UWSWRJLRBRUYAY-QRVIBDJDSA-N |
| XLogP | 6.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|