C20H15ClN4O8 — CID 126230008
2-[2-chloro-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126230008) has the molecular formula C20H15ClN4O8 and a molecular weight of 474.81 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126230008 |
| Molecular Formula | C20H15ClN4O8 |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C20H15ClN4O8/c1-32-15-7-10(6-14(21)17(15)33-9-16(22)26)5-13-18(27)23-20(29)24(19(13)28)11-3-2-4-12(8-11)25(30)31/h2-8H,9H2,1H3,(H2,22,26)(H,23,27,29)/b13-5+ |
| InChIKey | IFVSIQAMBPBWIJ-WLRTZDKTSA-N |
| XLogP | 1.79 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|