C24H15BrClN3O9S — CID 126074823
[2-bromo-6-methoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126074823) has the molecular formula C24H15BrClN3O9S and a molecular weight of 636.82 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-6-methoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126074823 |
| Molecular Formula | C24H15BrClN3O9S |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 634.94 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15BrClN3O9S/c1-37-20-12-13(11-19(25)21(20)38-39(35,36)17-8-2-14(26)3-9-17)10-18-22(30)27-24(32)28(23(18)31)15-4-6-16(7-5-15)29(33)34/h2-12H,1H3,(H,27,30,32)/b18-10+ |
| InChIKey | SQZLXPCNMCIBQK-VCHYOVAHSA-N |
| XLogP | 4.45 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|