C26H20Cl2N2O7S — CID 126077806
[2-chloro-4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126077806) has the molecular formula C26H20Cl2N2O7S and a molecular weight of 575.43 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126077806 |
| Molecular Formula | C26H20Cl2N2O7S |
| Molecular Weight | 575.43 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | [2-chloro-4-[(E)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(C)c(C)c3)C2=O)cc(Cl)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20Cl2N2O7S/c1-14-4-7-18(10-15(14)2)30-25(32)20(24(31)29-26(30)33)11-16-12-21(28)23(22(13-16)36-3)37-38(34,35)19-8-5-17(27)6-9-19/h4-13H,1-3H3,(H,29,31,33)/b20-11+ |
| InChIKey | OGZXJAJTXHHYQX-RGVLZGJSSA-N |
| XLogP | 5.05 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|