C23H11Br2Cl3N2O6S — CID 126072912
[2,6-dibromo-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126072912) has the molecular formula C23H11Br2Cl3N2O6S and a molecular weight of 709.58 g/mol. Its IUPAC name is [2,6-dibromo-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,6-dibromo-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126072912 |
| Molecular Formula | C23H11Br2Cl3N2O6S |
| Molecular Weight | 709.58 g/mol |
| Exact Mass | 705.78 |
| IUPAC Name | [2,6-dibromo-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C/c1cc(Br)c(OS(=O)(=O)c2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H11Br2Cl3N2O6S/c24-16-8-11(9-17(25)20(16)36-37(34,35)14-4-1-12(26)2-5-14)7-15-21(31)29-23(33)30(22(15)32)13-3-6-18(27)19(28)10-13/h1-10H,(H,29,31,33)/b15-7+ |
| InChIKey | NIVWJGLQGDRWRW-VIZOYTHASA-N |
| XLogP | 6.61 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|