C23H12Br2ClN3O8S — CID 126073062
[2,6-dibromo-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126073062) has the molecular formula C23H12Br2ClN3O8S and a molecular weight of 685.69 g/mol. Its IUPAC name is [2,6-dibromo-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,6-dibromo-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126073062 |
| Molecular Formula | C23H12Br2ClN3O8S |
| Molecular Weight | 685.69 g/mol |
| Exact Mass | 682.84 |
| IUPAC Name | [2,6-dibromo-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C/c1cc(Br)c(OS(=O)(=O)c2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H12Br2ClN3O8S/c24-18-10-12(11-19(25)20(18)37-38(35,36)16-7-1-13(26)2-8-16)9-17-21(30)27-23(32)28(22(17)31)14-3-5-15(6-4-14)29(33)34/h1-11H,(H,27,30,32)/b17-9+ |
| InChIKey | CESGVLOABIEXRV-RQZCQDPDSA-N |
| XLogP | 5.21 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|