C23H15N3O8S — CID 126070765
[3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126070765) has the molecular formula C23H15N3O8S and a molecular weight of 493.45 g/mol. Its IUPAC name is [3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126070765 |
| Molecular Formula | C23H15N3O8S |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | [3-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C\c1cccc(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H15N3O8S/c27-21-20(22(28)25(23(29)24-21)16-9-11-17(12-10-16)26(30)31)14-15-5-4-6-18(13-15)34-35(32,33)19-7-2-1-3-8-19/h1-14H,(H,24,27,29)/b20-14- |
| InChIKey | CSCZUCCSJDTLNU-ZHZULCJRSA-N |
| XLogP | 3.03 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|