C17H9Cl2N3O5 — CID 126223846
(5E)-5-[(2,6-dichlorophenyl)methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126223846) has the molecular formula C17H9Cl2N3O5 and a molecular weight of 406.18 g/mol. Its IUPAC name is (5E)-5-[(2,6-dichlorophenyl)methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2,6-dichlorophenyl)methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126223846 |
| Molecular Formula | C17H9Cl2N3O5 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | (5E)-5-[(2,6-dichlorophenyl)methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H9Cl2N3O5/c18-13-2-1-3-14(19)11(13)8-12-15(23)20-17(25)21(16(12)24)9-4-6-10(7-5-9)22(26)27/h1-8H,(H,20,23,25)/b12-8+ |
| InChIKey | RDNAUYCSFIIJEV-XYOKQWHBSA-N |
| XLogP | 3.57 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|