C28H23IN4O8 — CID 126256055
N-(2,5-dimethylphenyl)-2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126256055) has the molecular formula C28H23IN4O8 and a molecular weight of 670.42 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126256055 |
| Molecular Formula | C28H23IN4O8 |
| Molecular Weight | 670.42 g/mol |
| Exact Mass | 670.06 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C2/C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc(I)c1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C28H23IN4O8/c1-15-7-8-16(2)22(9-15)30-24(34)14-41-25-21(29)11-17(12-23(25)40-3)10-20-26(35)31-28(37)32(27(20)36)18-5-4-6-19(13-18)33(38)39/h4-13H,14H2,1-3H3,(H,30,34)(H,31,35,37)/b20-10- |
| InChIKey | JAKDVFYTIZIKHR-JMIUGGIZSA-N |
| XLogP | 4.51 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|