C29H25BrN4O8 — CID 126256594
2-[2-bromo-6-ethoxy-4-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 126256594) has the molecular formula C29H25BrN4O8 and a molecular weight of 637.44 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126256594 |
| Molecular Formula | C29H25BrN4O8 |
| Molecular Weight | 637.44 g/mol |
| Exact Mass | 636.09 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc(Br)c1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C29H25BrN4O8/c1-4-41-24-14-18(13-22(30)26(24)42-15-25(35)31-23-11-16(2)5-6-17(23)3)12-21-27(36)32-29(38)33(28(21)37)19-7-9-20(10-8-19)34(39)40/h5-14H,4,15H2,1-3H3,(H,31,35)(H,32,36,38)/b21-12- |
| InChIKey | LIVBZWNMHLDQRM-MTJSOVHGSA-N |
| XLogP | 5.06 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|