C27H20Cl2N4O8 — CID 126225020
2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126225020) has the molecular formula C27H20Cl2N4O8 and a molecular weight of 599.38 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126225020 |
| Molecular Formula | C27H20Cl2N4O8 |
| Molecular Weight | 599.38 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc(Cl)c1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20Cl2N4O8/c1-2-40-22-13-15(12-21(29)24(22)41-14-23(34)30-17-5-3-16(28)4-6-17)11-20-25(35)31-27(37)32(26(20)36)18-7-9-19(10-8-18)33(38)39/h3-13H,2,14H2,1H3,(H,30,34)(H,31,35,37)/b20-11+ |
| InChIKey | LFBJNDWNDPVNAR-RGVLZGJSSA-N |
| XLogP | 4.98 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|